C28H24F8O3S — CID 118220887
2-fluoro-1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene (PubChem CID 118220887) has the molecular formula C28H24F8O3S and a molecular weight of 592.55 g/mol. Its IUPAC name is 2-fluoro-1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene.
| Compound Name | 2-fluoro-1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 118220887 |
| Molecular Formula | C28H24F8O3S |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-fluoro-1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene |
| SMILES | Cc1ccc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C28H24F8O3S/c1-18-4-5-19(24(30)16-18)17-39-26(27(31,32)33,28(34,35)36)21-8-6-20(7-9-21)25(14-2-3-15-25)40(37,38)23-12-10-22(29)11-13-23/h4-13,16H,2-3,14-15,17H2,1H3 |
| InChIKey | BTKFYQCMJGBPKB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |