C24H24F6O3S — CID 118220913
1-[1-(benzenesulfonyl)cyclopent-3-en-1-yl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene (PubChem CID 118220913) has the molecular formula C24H24F6O3S and a molecular weight of 506.51 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)cyclopent-3-en-1-yl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene.
| Compound Name | 1-[1-(benzenesulfonyl)cyclopent-3-en-1-yl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 118220913 |
| Molecular Formula | C24H24F6O3S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 1-[1-(benzenesulfonyl)cyclopent-3-en-1-yl]-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
| SMILES | CCCCOC(c1ccc(C2(S(=O)(=O)c3ccccc3)CC=CC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H24F6O3S/c1-2-3-17-33-22(23(25,26)27,24(28,29)30)19-13-11-18(12-14-19)21(15-7-8-16-21)34(31,32)20-9-5-4-6-10-20/h4-14H,2-3,15-17H2,1H3 |
| InChIKey | UKQRPNYEMLAWCX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|