C25H28F6O4S — CID 118220973
[3-(benzenesulfonyl)-3-[4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]cyclopentyl]methanol (PubChem CID 118220973) has the molecular formula C25H28F6O4S and a molecular weight of 538.55 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-3-[4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]cyclopentyl]methanol.
| Compound Name | [3-(benzenesulfonyl)-3-[4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 118220973 |
| Molecular Formula | C25H28F6O4S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | [3-(benzenesulfonyl)-3-[4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]cyclopentyl]methanol |
| SMILES | CCCCOC(c1ccc(C2(S(=O)(=O)c3ccccc3)CCC(CO)C2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H28F6O4S/c1-2-3-15-35-23(24(26,27)28,25(29,30)31)20-11-9-19(10-12-20)22(14-13-18(16-22)17-32)36(33,34)21-7-5-4-6-8-21/h4-12,18,32H,2-3,13-17H2,1H3 |
| InChIKey | XMQREDGTMRQSKP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|