C28H23F9O4S — CID 118220990
1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methoxybenzene (PubChem CID 118220990) has the molecular formula C28H23F9O4S and a molecular weight of 626.54 g/mol. Its IUPAC name is 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methoxybenzene.
| Compound Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 118220990 |
| Molecular Formula | C28H23F9O4S |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methoxybenzene |
| SMILES | COc1ccc(F)c(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)c1F |
| InChI | InChI=1S/C28H23F9O4S/c1-40-23-13-12-22(30)21(24(23)31)16-41-26(27(32,33)34,28(35,36)37)18-6-4-17(5-7-18)25(14-2-3-15-25)42(38,39)20-10-8-19(29)9-11-20/h4-13H,2-3,14-16H2,1H3 |
| InChIKey | XCMRNOHURFFKQU-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |