C26H24F7NO4S — CID 118221007
4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 118221007) has the molecular formula C26H24F7NO4S and a molecular weight of 579.53 g/mol. Its IUPAC name is 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 118221007 |
| Molecular Formula | C26H24F7NO4S |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1COC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H24F7NO4S/c1-16-22(17(2)38-34-16)15-37-24(25(28,29)30,26(31,32)33)19-7-5-18(6-8-19)23(13-3-4-14-23)39(35,36)21-11-9-20(27)10-12-21/h5-12H,3-4,13-15H2,1-2H3 |
| InChIKey | ZSKXQRLXSYSGCU-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |