About (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine
(Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine (PubChem CID 118221186) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine |
| PubChem CID | 118221186 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine |
| SMILES | C=CN(CC(C)C)/C(=C\N)COC |
| InChI | InChI=1S/C10H20N2O/c1-5-12(7-9(2)3)10(6-11)8-13-4/h5-6,9H,1,7-8,11H2,2-4H3/b10-6- |
| InChIKey | ADOHCOWAJBQKEW-POHAHGRESA-N |
| XLogP | 1.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine?
The IUPAC name of (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine (CID 118221186) is (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine?
The canonical SMILES for (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine is C=CN(CC(C)C)/C(=C\N)COC.
What is the InChIKey of (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine?
The InChIKey is ADOHCOWAJBQKEW-POHAHGRESA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-12(7-9(2)3)10(6-11)8-13-4/h5-6,9H,1,7-8,11H2,2-4H3/b10-6-.
What are the key properties of (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine?
(Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine has a molecular weight of 184.28 g/mol, XLogP of 1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N-ethenyl-3-methoxy-2-N-(2-methylpropyl)prop-1-ene-1,2-diamine is sourced from PubChem (CID 118221186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).