C5ClF9O — CID 11822120
1-chloro-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one (PubChem CID 11822120) has the molecular formula C5ClF9O and a molecular weight of 282.49 g/mol. Its IUPAC name is 1-chloro-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one.
| Compound Name | 1-chloro-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one |
|---|---|
| PubChem CID | 11822120 |
| Molecular Formula | C5ClF9O |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1-chloro-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one |
| SMILES | O=C(C(F)(F)Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5ClF9O/c6-3(9,10)1(16)2(7,8)4(11,12)5(13,14)15 |
| InChIKey | SVLKNEDERQZEJL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|