C12H18F6 — CID 118221471
1,2,3,4,5,6-hexafluorocyclododecane (PubChem CID 118221471) has the molecular formula C12H18F6 and a molecular weight of 276.26 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexafluorocyclododecane.
| Compound Name | 1,2,3,4,5,6-hexafluorocyclododecane |
|---|---|
| PubChem CID | 118221471 |
| Molecular Formula | C12H18F6 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1,2,3,4,5,6-hexafluorocyclododecane |
| SMILES | FC1CCCCCCC(F)C(F)C(F)C(F)C1F |
| InChI | InChI=1S/C12H18F6/c13-7-5-3-1-2-4-6-8(14)10(16)12(18)11(17)9(7)15/h7-12H,1-6H2 |
| InChIKey | LOCMILGGAUCLBF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |