About (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal
(4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal (PubChem CID 118221655) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal.
Molecular Properties
| Compound Name | (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal |
| PubChem CID | 118221655 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal |
| SMILES | C[C@H](CO)C(=O)C(C)(C)C=O |
| InChI | InChI=1S/C8H14O3/c1-6(4-9)7(11)8(2,3)5-10/h5-6,9H,4H2,1-3H3/t6-/m1/s1 |
| InChIKey | WBLZGXCWDFYNIQ-ZCFIWIBFSA-N |
| XLogP | 0.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal?
The IUPAC name of (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal (CID 118221655) is (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal.
What is the SMILES notation for (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal?
The canonical SMILES for (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal is C[C@H](CO)C(=O)C(C)(C)C=O.
What is the InChIKey of (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal?
The InChIKey is WBLZGXCWDFYNIQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14O3/c1-6(4-9)7(11)8(2,3)5-10/h5-6,9H,4H2,1-3H3/t6-/m1/s1.
What are the key properties of (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal?
(4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal has a molecular weight of 158.20 g/mol, XLogP of 0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-hydroxy-2,2,4-trimethyl-3-oxopentanal is sourced from PubChem (CID 118221655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).