C30H23N5O2S2 — CID 118222015
1-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanyl-[1,2,4]triazino[5,6-b]indol-5-yl]pent-4-yn-1-one (PubChem CID 118222015) has the molecular formula C30H23N5O2S2 and a molecular weight of 549.68 g/mol. Its IUPAC name is 1-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanyl-[1,2,4]triazino[5,6-b]indol-5-yl]pent-4-yn-1-one.
| Compound Name | 1-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanyl-[1,2,4]triazino[5,6-b]indol-5-yl]pent-4-yn-1-one |
|---|---|
| PubChem CID | 118222015 |
| Molecular Formula | C30H23N5O2S2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 1-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanyl-[1,2,4]triazino[5,6-b]indol-5-yl]pent-4-yn-1-one |
| SMILES | C#CCCC(=O)n1c2ccccc2c2nnc(SC(CC)C(=O)N3c4ccccc4Sc4ccccc43)nc21 |
| InChI | InChI=1S/C30H23N5O2S2/c1-3-5-18-26(36)35-20-13-7-6-12-19(20)27-28(35)31-30(33-32-27)39-23(4-2)29(37)34-21-14-8-10-16-24(21)38-25-17-11-9-15-22(25)34/h1,6-17,23H,4-5,18H2,2H3 |
| InChIKey | HXNXFBNAIIOCAZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|