C16H15BrF12O4 — CID 118222030
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-(bromomethyl)prop-2-enoate (PubChem CID 118222030) has the molecular formula C16H15BrF12O4 and a molecular weight of 579.17 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-(bromomethyl)prop-2-enoate.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-(bromomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 118222030 |
| Molecular Formula | C16H15BrF12O4 |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 578.00 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-(bromomethyl)prop-2-enoate |
| SMILES | C=C(CBr)C(=O)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H15BrF12O4/c1-6(5-17)10(30)33-9-3-7(11(31,13(18,19)20)14(21,22)23)2-8(4-9)12(32,15(24,25)26)16(27,28)29/h7-9,31-32H,1-5H2 |
| InChIKey | DOQNAWXNGUXEOX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|