C11H15N3O4S — CID 11822212
(2R)-2-(1,1-dioxo-4,5-dihydro-3H-1lambda6,2,5-benzothiadiazepin-2-yl)-N-hydroxypropanamide (PubChem CID 11822212) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is (2R)-2-(1,1-dioxo-4,5-dihydro-3H-1lambda6,2,5-benzothiadiazepin-2-yl)-N-hydroxypropanamide.
| Compound Name | (2R)-2-(1,1-dioxo-4,5-dihydro-3H-1lambda6,2,5-benzothiadiazepin-2-yl)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 11822212 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2R)-2-(1,1-dioxo-4,5-dihydro-3H-1lambda6,2,5-benzothiadiazepin-2-yl)-N-hydroxypropanamide |
| SMILES | C[C@H](C(=O)NO)N1CCNc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C11H15N3O4S/c1-8(11(15)13-16)14-7-6-12-9-4-2-3-5-10(9)19(14,17)18/h2-5,8,12,16H,6-7H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | ZPDVGCNXBJNBDB-MRVPVSSYSA-N |
| XLogP | -0.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|