About 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde
6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde (PubChem CID 118222370) has the molecular formula C11H6F8O2S
and a molecular weight of 354.22 g/mol. Its IUPAC name is 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde |
| PubChem CID | 118222370 |
| Molecular Formula | C11H6F8O2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde |
| SMILES | O=CC1=Cc2cc(S(F)(F)(F)(F)F)ccc2OC1C(F)(F)F |
| InChI | InChI=1S/C11H6F8O2S/c12-11(13,14)10-7(5-20)3-6-4-8(1-2-9(6)21-10)22(15,16,17,18)19/h1-5,10H |
| InChIKey | AEVMGUZAIYUSQZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde?
The IUPAC name of 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde (CID 118222370) is 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde.
What is the SMILES notation for 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde?
The canonical SMILES for 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde is O=CC1=Cc2cc(S(F)(F)(F)(F)F)ccc2OC1C(F)(F)F.
What is the InChIKey of 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde?
The InChIKey is AEVMGUZAIYUSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F8O2S/c12-11(13,14)10-7(5-20)3-6-4-8(1-2-9(6)21-10)22(15,16,17,18)19/h1-5,10H.
What are the key properties of 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde?
6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde has a molecular weight of 354.22 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde is sourced from PubChem (CID 118222370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).