About dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate
dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate (PubChem CID 11822250) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate |
| PubChem CID | 11822250 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate |
| SMILES | CCCCC(C(=O)OC)C(C)(C)/C=C(/OC)C(=O)OC |
| InChI | InChI=1S/C15H26O5/c1-7-8-9-11(13(16)19-5)15(2,3)10-12(18-4)14(17)20-6/h10-11H,7-9H2,1-6H3/b12-10+ |
| InChIKey | FZITYXXJADQBMO-ZRDIBKRKSA-N |
| XLogP | 2.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate?
The IUPAC name of dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate (CID 11822250) is dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate.
What is the SMILES notation for dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate?
The canonical SMILES for dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate is CCCCC(C(=O)OC)C(C)(C)/C=C(/OC)C(=O)OC.
What is the InChIKey of dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate?
The InChIKey is FZITYXXJADQBMO-ZRDIBKRKSA-N. The full InChI is InChI=1S/C15H26O5/c1-7-8-9-11(13(16)19-5)15(2,3)10-12(18-4)14(17)20-6/h10-11H,7-9H2,1-6H3/b12-10+.
What are the key properties of dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate?
dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate has a molecular weight of 286.37 g/mol, XLogP of 2.70, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-5-butyl-2-methoxy-4,4-dimethylhex-2-enedioate is sourced from PubChem (CID 11822250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).