C18H24ClN3O2 — CID 118222574
2-chloro-5-[(3,5-dimethoxyanilino)methyl]-N,3-diethylpyridin-4-amine (PubChem CID 118222574) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-chloro-5-[(3,5-dimethoxyanilino)methyl]-N,3-diethylpyridin-4-amine.
| Compound Name | 2-chloro-5-[(3,5-dimethoxyanilino)methyl]-N,3-diethylpyridin-4-amine |
|---|---|
| PubChem CID | 118222574 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-chloro-5-[(3,5-dimethoxyanilino)methyl]-N,3-diethylpyridin-4-amine |
| SMILES | CCNc1c(CNc2cc(OC)cc(OC)c2)cnc(Cl)c1CC |
| InChI | InChI=1S/C18H24ClN3O2/c1-5-16-17(20-6-2)12(11-22-18(16)19)10-21-13-7-14(23-3)9-15(8-13)24-4/h7-9,11,21H,5-6,10H2,1-4H3,(H,20,22) |
| InChIKey | HYSKHJOKFHWGTB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|