About 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one
7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one (PubChem CID 118222577) has the molecular formula C19H18ClFN2O3
and a molecular weight of 376.82 g/mol. Its IUPAC name is 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one |
| PubChem CID | 118222577 |
| Molecular Formula | C19H18ClFN2O3 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one |
| SMILES | COc1cc(OC)c(F)c(-c2cc3cnc(Cl)cc3n(C(C)C)c2=O)c1 |
| InChI | InChI=1S/C19H18ClFN2O3/c1-10(2)23-15-8-17(20)22-9-11(15)5-14(19(23)24)13-6-12(25-3)7-16(26-4)18(13)21/h5-10H,1-4H3 |
| InChIKey | CLJIARPPQBDCIU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one?
The IUPAC name of 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one (CID 118222577) is 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one.
What is the SMILES notation for 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one?
The canonical SMILES for 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one is COc1cc(OC)c(F)c(-c2cc3cnc(Cl)cc3n(C(C)C)c2=O)c1.
What is the InChIKey of 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one?
The InChIKey is CLJIARPPQBDCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClFN2O3/c1-10(2)23-15-8-17(20)22-9-11(15)5-14(19(23)24)13-6-12(25-3)7-16(26-4)18(13)21/h5-10H,1-4H3.
What are the key properties of 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one?
7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one has a molecular weight of 376.82 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(2-fluoro-3,5-dimethoxyphenyl)-1-propan-2-yl-1,6-naphthyridin-2-one is sourced from PubChem (CID 118222577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).