About [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate
[(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate (PubChem CID 11822271) has the molecular formula C9H6ClF3O3S
and a molecular weight of 286.66 g/mol. Its IUPAC name is [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate |
| PubChem CID | 11822271 |
| Molecular Formula | C9H6ClF3O3S |
| Molecular Weight | 286.66 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(O/C=C(\F)C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6ClF3O3S/c10-6-1-3-7(4-2-6)17(14,15)16-5-8(11)9(12)13/h1-5,9H/b8-5- |
| InChIKey | OCFLPVZWUMKXAB-YVMONPNESA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate?
The IUPAC name of [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate (CID 11822271) is [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate.
What is the SMILES notation for [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate?
The canonical SMILES for [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate is O=S(=O)(O/C=C(\F)C(F)F)c1ccc(Cl)cc1.
What is the InChIKey of [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate?
The InChIKey is OCFLPVZWUMKXAB-YVMONPNESA-N. The full InChI is InChI=1S/C9H6ClF3O3S/c10-6-1-3-7(4-2-6)17(14,15)16-5-8(11)9(12)13/h1-5,9H/b8-5-.
What are the key properties of [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate?
[(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate has a molecular weight of 286.66 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,3,3-trifluoroprop-1-enyl] 4-chlorobenzenesulfonate is sourced from PubChem (CID 11822271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).