C25H28F3N5O2S — CID 118222921
(3S,6R)-2-[[2,5-difluoro-4-[(3R,4S)-3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide (PubChem CID 118222921) has the molecular formula C25H28F3N5O2S and a molecular weight of 519.59 g/mol. Its IUPAC name is (3S,6R)-2-[[2,5-difluoro-4-[(3R,4S)-3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide.
| Compound Name | (3S,6R)-2-[[2,5-difluoro-4-[(3R,4S)-3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 118222921 |
| Molecular Formula | C25H28F3N5O2S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (3S,6R)-2-[[2,5-difluoro-4-[(3R,4S)-3-fluoro-4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(N2CC[C@H](n3cnnc3)[C@H](F)C2)cc1F |
| InChI | InChI=1S/C25H28F3N5O2S/c1-17-7-8-25(18-5-3-2-4-6-18)36(34,35)33(17)13-19-11-21(27)24(12-20(19)26)31-10-9-23(22(28)14-31)32-15-29-30-16-32/h2-6,11-12,15-17,22-23,25H,7-10,13-14H2,1H3/t17-,22+,23-,25+/m0/s1 |
| InChIKey | SQCNQJLVQLTVSN-YMACDFMISA-N |
| XLogP | 4.40 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|