C25H26F5N5O2S — CID 118222936
(3R,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazinane 1,1-dioxide (PubChem CID 118222936) has the molecular formula C25H26F5N5O2S and a molecular weight of 555.57 g/mol. Its IUPAC name is (3R,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazinane 1,1-dioxide.
| Compound Name | (3R,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 118222936 |
| Molecular Formula | C25H26F5N5O2S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | (3R,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-6-phenyl-3-(trifluoromethyl)thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)[C@@H](c2ccccc2)CC[C@H](C(F)(F)F)N1Cc1cc(F)c(N2CCC(n3cnnc3)CC2)cc1F |
| InChI | InChI=1S/C25H26F5N5O2S/c26-20-13-22(33-10-8-19(9-11-33)34-15-31-32-16-34)21(27)12-18(20)14-35-24(25(28,29)30)7-6-23(38(35,36)37)17-4-2-1-3-5-17/h1-5,12-13,15-16,19,23-24H,6-11,14H2/t23-,24-/m1/s1 |
| InChIKey | MGLBELNSPGPLKZ-DNQXCXABSA-N |
| XLogP | 5.00 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|