C21H25F2NO4S — CID 118222967
2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]propane-1,3-diol (PubChem CID 118222967) has the molecular formula C21H25F2NO4S and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]propane-1,3-diol.
| Compound Name | 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 118222967 |
| Molecular Formula | C21H25F2NO4S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]propane-1,3-diol |
| SMILES | C[C@@H]1NC[C@@H](c2ccccc2)S(=O)(=O)C1Cc1cc(F)c(C(CO)CO)cc1F |
| InChI | InChI=1S/C21H25F2NO4S/c1-13-20(29(27,28)21(10-24-13)14-5-3-2-4-6-14)8-15-7-19(23)17(9-18(15)22)16(11-25)12-26/h2-7,9,13,16,20-21,24-26H,8,10-12H2,1H3/t13-,20?,21-/m0/s1 |
| InChIKey | NVGWMNXJHYBRDF-CMVRGNNWSA-N |
| XLogP | 2.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |