C24H28FNO3S — CID 118222980
(3S,6R)-2-[[4-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide (PubChem CID 118222980) has the molecular formula C24H28FNO3S and a molecular weight of 429.56 g/mol. Its IUPAC name is (3S,6R)-2-[[4-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide.
| Compound Name | (3S,6R)-2-[[4-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 118222980 |
| Molecular Formula | C24H28FNO3S |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (3S,6R)-2-[[4-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1ccc(CC2=CCOCC2)cc1F |
| InChI | InChI=1S/C24H28FNO3S/c1-18-7-10-24(21-5-3-2-4-6-21)30(27,28)26(18)17-22-9-8-20(16-23(22)25)15-19-11-13-29-14-12-19/h2-6,8-9,11,16,18,24H,7,10,12-15,17H2,1H3/t18-,24+/m0/s1 |
| InChIKey | IBIFFFLYLLBVHN-MHECFPHRSA-N |
| XLogP | 4.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|