C21H19F2NO4S — CID 118222983
methyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate (PubChem CID 118222983) has the molecular formula C21H19F2NO4S and a molecular weight of 419.45 g/mol. Its IUPAC name is methyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate.
| Compound Name | methyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 118222983 |
| Molecular Formula | C21H19F2NO4S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(F)c(CN2S[C@H](c3ccccc3)C(=O)C(=O)[C@@H]2C)cc1F |
| InChI | InChI=1S/C21H19F2NO4S/c1-12-19(26)20(27)21(13-6-4-3-5-7-13)29-24(12)11-15-9-16(22)14(8-17(15)23)10-18(25)28-2/h3-9,12,21H,10-11H2,1-2H3/t12-,21+/m0/s1 |
| InChIKey | TWNCDNOQCALEIJ-LAJNKCICSA-N |
| XLogP | 3.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|