C25H29F2NO6S — CID 118223067
diethyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propanedioate (PubChem CID 118223067) has the molecular formula C25H29F2NO6S and a molecular weight of 509.57 g/mol. Its IUPAC name is diethyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propanedioate.
| Compound Name | diethyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propanedioate |
|---|---|
| PubChem CID | 118223067 |
| Molecular Formula | C25H29F2NO6S |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | diethyl 2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cc(F)c(CN2[C@@H](C)CC[C@H](c3ccccc3)S2(=O)=O)cc1F |
| InChI | InChI=1S/C25H29F2NO6S/c1-4-33-24(29)23(25(30)34-5-2)19-14-20(26)18(13-21(19)27)15-28-16(3)11-12-22(35(28,31)32)17-9-7-6-8-10-17/h6-10,13-14,16,22-23H,4-5,11-12,15H2,1-3H3/t16-,22+/m0/s1 |
| InChIKey | DSAMYGQVZZXQFO-KSFYIVLOSA-N |
| XLogP | 4.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|