C27H32FN5O4S — CID 118223088
methyl (3R,4R)-1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)piperidine-3-carboxylate (PubChem CID 118223088) has the molecular formula C27H32FN5O4S and a molecular weight of 541.65 g/mol. Its IUPAC name is methyl (3R,4R)-1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)piperidine-3-carboxylate.
| Compound Name | methyl (3R,4R)-1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 118223088 |
| Molecular Formula | C27H32FN5O4S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | methyl (3R,4R)-1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CC[C@H]1n1cnnc1 |
| InChI | InChI=1S/C27H32FN5O4S/c1-19-8-11-26(20-6-4-3-5-7-20)38(35,36)33(19)15-21-9-10-22(14-24(21)28)31-13-12-25(32-17-29-30-18-32)23(16-31)27(34)37-2/h3-7,9-10,14,17-19,23,25-26H,8,11-13,15-16H2,1-2H3/t19-,23+,25+,26+/m0/s1 |
| InChIKey | WPUWKVQOEQZUKY-JNXIGMILSA-N |
| XLogP | 3.71 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|