C12H18O6S — CID 11822389
[(3aR,4S,6S,6aS)-6-(acetylsulfanylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 11822389) has the molecular formula C12H18O6S and a molecular weight of 290.34 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-6-(acetylsulfanylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,6S,6aS)-6-(acetylsulfanylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11822389 |
| Molecular Formula | C12H18O6S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [(3aR,4S,6S,6aS)-6-(acetylsulfanylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](CSC(C)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18O6S/c1-6(13)15-11-10-9(17-12(3,4)18-10)8(16-11)5-19-7(2)14/h8-11H,5H2,1-4H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | KNDRQALXJBGRKN-GWOFURMSSA-N |
| XLogP | 1.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|