C12H14ClN3OS — CID 118224184
(2S,6R)-4-(5-chloro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-2,6-dimethylmorpholine (PubChem CID 118224184) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is (2S,6R)-4-(5-chloro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(5-chloro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 118224184 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2S,6R)-4-(5-chloro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2nc3nc(Cl)ccc3s2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-7-5-16(6-8(2)17-7)12-15-11-9(18-12)3-4-10(13)14-11/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | PJEQIWSLIYZAOV-OCAPTIKFSA-N |
| XLogP | 2.96 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|