About CA-4948
CA-4948 (PubChem CID 118224238) has the molecular formula C21H19N7O3
and a molecular weight of 417.40 g/mol. Its IUPAC name is 6-(6-amino-3-pyridinyl)-N-(2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridin-6-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | CA-4948 |
| PubChem CID | 118224238 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 6-(6-amino-3-pyridinyl)-N-(2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridin-6-yl)pyridine-2-carboxamide |
| SMILES | C1COCCN1C2=NC3=C(O2)C=C(C=N3)NC(=O)C4=CC=CC(=N4)C5=CN=C(C=C5)N |
| InChI | InChI=1S/C21H19N7O3/c22-18-5-4-13(11-23-18)15-2-1-3-16(26-15)20(29)25-14-10-17-19(24-12-14)27-21(31-17)28-6-8-30-9-7-28/h1-5,10-12H,6-9H2,(H2,22,23)(H,25,29) |
| InChIKey | RWIMETUXCNDSLE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | 620 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CA-4948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CA-4948?
The IUPAC name of CA-4948 (CID 118224238) is 6-(6-amino-3-pyridinyl)-N-(2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridin-6-yl)pyridine-2-carboxamide.
What is the SMILES notation for CA-4948?
The canonical SMILES for CA-4948 is C1COCCN1C2=NC3=C(O2)C=C(C=N3)NC(=O)C4=CC=CC(=N4)C5=CN=C(C=C5)N.
What is the InChIKey of CA-4948?
The InChIKey is RWIMETUXCNDSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N7O3/c22-18-5-4-13(11-23-18)15-2-1-3-16(26-15)20(29)25-14-10-17-19(24-12-14)27-21(31-17)28-6-8-30-9-7-28/h1-5,10-12H,6-9H2,(H2,22,23)(H,25,29).
What are the key properties of CA-4948?
CA-4948 has a molecular weight of 417.40 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CA-4948 is sourced from PubChem (CID 118224238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).