C17H26O4 — CID 11822516
methyl (1'S,4'aR,8'aR)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,8-tetrahydro-1H-naphthalene]-1'-carboxylate (PubChem CID 11822516) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl (1'S,4'aR,8'aR)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,8-tetrahydro-1H-naphthalene]-1'-carboxylate.
| Compound Name | methyl (1'S,4'aR,8'aR)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,8-tetrahydro-1H-naphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 11822516 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl (1'S,4'aR,8'aR)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,8-tetrahydro-1H-naphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@@H]1C2(CC[C@@H]3C(C)(C)C=CC[C@]31C)OCCO2 |
| InChI | InChI=1S/C17H26O4/c1-15(2)7-5-8-16(3)12(15)6-9-17(20-10-11-21-17)13(16)14(18)19-4/h5,7,12-13H,6,8-11H2,1-4H3/t12-,13+,16-/m1/s1 |
| InChIKey | IJMHASNDYFKPGP-DVOMOZLQSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|