C30H31N3O3 — CID 118225179
ethyl 3-[4-[[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate (PubChem CID 118225179) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is ethyl 3-[4-[[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | ethyl 3-[4-[[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 118225179 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | ethyl 3-[4-[[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OCC)c1ccc(OCc2cc(-c3ccc(C(C)C)cc3)cn3ncnc23)cc1 |
| InChI | InChI=1S/C30H31N3O3/c1-5-7-25(17-29(34)35-6-2)23-12-14-28(15-13-23)36-19-27-16-26(18-33-30(27)31-20-32-33)24-10-8-22(9-11-24)21(3)4/h8-16,18,20-21,25H,6,17,19H2,1-4H3 |
| InChIKey | DEKPEZYBYZEJEC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|