C10H19NO3 — CID 118225402
(E)-4,7-dihydroxy-N,N,4-trimethylhept-5-enamide (PubChem CID 118225402) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-4,7-dihydroxy-N,N,4-trimethylhept-5-enamide.
| Compound Name | (E)-4,7-dihydroxy-N,N,4-trimethylhept-5-enamide |
|---|---|
| PubChem CID | 118225402 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E)-4,7-dihydroxy-N,N,4-trimethylhept-5-enamide |
| SMILES | CN(C)C(=O)CCC(C)(O)/C=C/CO |
| InChI | InChI=1S/C10H19NO3/c1-10(14,6-4-8-12)7-5-9(13)11(2)3/h4,6,12,14H,5,7-8H2,1-3H3/b6-4+ |
| InChIKey | FILLBYPLCLCLRS-GQCTYLIASA-N |
| XLogP | 0.15 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|