C9H16ClNO5 — CID 118225455
N-[(2S,3R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]acetamide (PubChem CID 118225455) has the molecular formula C9H16ClNO5 and a molecular weight of 253.68 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 118225455 |
| Molecular Formula | C9H16ClNO5 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[(2S,3R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]acetamide |
| SMILES | CO[C@H]1O[C@H](CCl)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C9H16ClNO5/c1-4(12)11-6-8(14)7(13)5(3-10)16-9(6)15-2/h5-9,13-14H,3H2,1-2H3,(H,11,12)/t5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | PPAODIYERXISGK-OKNNCHMLSA-N |
| XLogP | -1.18 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|