C25H36N3O9P — CID 118225779
[2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 118225779) has the molecular formula C25H36N3O9P and a molecular weight of 553.55 g/mol. Its IUPAC name is [2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 118225779 |
| Molecular Formula | C25H36N3O9P |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | [2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(P(=O)(O)O)c(OCC)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C25H36N3O9P/c1-4-7-8-9-18(19(5-2)28(32)16-29)24(30)26-15-27-25(31)21-12-11-20(37-21)17-10-13-23(38(33,34)35)22(14-17)36-6-3/h10-14,16,18-19,32H,4-9,15H2,1-3H3,(H,26,30)(H,27,31)(H2,33,34,35)/t18-,19-/m1/s1 |
| InChIKey | FGXIOOMXSBYXDY-RTBURBONSA-N |
| XLogP | 2.77 |
| TPSA | 178.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|