C18H32O3 — CID 11822586
(E)-4-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-2-methylbut-2-en-1-ol (PubChem CID 11822586) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (E)-4-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-2-methylbut-2-en-1-ol.
| Compound Name | (E)-4-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-2-methylbut-2-en-1-ol |
|---|---|
| PubChem CID | 11822586 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (E)-4-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-2-methylbut-2-en-1-ol |
| SMILES | COC(OC)[C@@H]1[C@@H](C(C)C)CC=C(C)[C@@H]1C/C=C(\C)CO |
| InChI | InChI=1S/C18H32O3/c1-12(2)15-10-8-14(4)16(9-7-13(3)11-19)17(15)18(20-5)21-6/h7-8,12,15-19H,9-11H2,1-6H3/b13-7+/t15-,16+,17-/m1/s1 |
| InChIKey | NEBQTRYNAFXRTD-WAJZILQWSA-N |
| XLogP | 3.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|