About 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one
1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one (PubChem CID 11822610) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one.
Molecular Properties
| Compound Name | 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one |
| PubChem CID | 11822610 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one |
| SMILES | C=C(C1=CCCc2cc(OC)ccc21)N1CCCCCC1=O |
| InChI | InChI=1S/C19H23NO2/c1-14(20-12-5-3-4-9-19(20)21)17-8-6-7-15-13-16(22-2)10-11-18(15)17/h8,10-11,13H,1,3-7,9,12H2,2H3 |
| InChIKey | UQBOMGBBRRACNH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one?
The IUPAC name of 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one (CID 11822610) is 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one.
What is the SMILES notation for 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one?
The canonical SMILES for 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one is C=C(C1=CCCc2cc(OC)ccc21)N1CCCCCC1=O.
What is the InChIKey of 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one?
The InChIKey is UQBOMGBBRRACNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO2/c1-14(20-12-5-3-4-9-19(20)21)17-8-6-7-15-13-16(22-2)10-11-18(15)17/h8,10-11,13H,1,3-7,9,12H2,2H3.
What are the key properties of 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one?
1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one has a molecular weight of 297.40 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6-methoxy-3,4-dihydronaphthalen-1-yl)ethenyl]azepan-2-one is sourced from PubChem (CID 11822610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).