About 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine
2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine (PubChem CID 118226304) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine |
| PubChem CID | 118226304 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCCOC[C@H]1C[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C14H25NO3/c15-3-4-16-5-6-17-7-8-18-11-14-10-12-1-2-13(14)9-12/h1-2,12-14H,3-11,15H2/t12-,13-,14-/m1/s1 |
| InChIKey | XTQLVYADYNFBDT-MGPQQGTHSA-N |
| XLogP | 1.21 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine?
The IUPAC name of 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine (CID 118226304) is 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine.
What is the SMILES notation for 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine?
The canonical SMILES for 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine is NCCOCCOCCOC[C@H]1C[C@@H]2C=C[C@@H]1C2.
What is the InChIKey of 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine?
The InChIKey is XTQLVYADYNFBDT-MGPQQGTHSA-N. The full InChI is InChI=1S/C14H25NO3/c15-3-4-16-5-6-17-7-8-18-11-14-10-12-1-2-13(14)9-12/h1-2,12-14H,3-11,15H2/t12-,13-,14-/m1/s1.
What are the key properties of 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine?
2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine has a molecular weight of 255.36 g/mol, XLogP of 1.21, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxy]ethoxy]ethoxy]ethanamine is sourced from PubChem (CID 118226304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).