C20H19FN4O4S2 — CID 118226926
N-[2-(cyclopropylamino)-2-oxoethyl]-2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-methylsulfonylacetamide (PubChem CID 118226926) has the molecular formula C20H19FN4O4S2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 118226926 |
| Molecular Formula | C20H19FN4O4S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)C(C(=O)NCC(=O)NC1CC1)c1nc2ccc(-c3ccc(F)nc3)cc2s1 |
| InChI | InChI=1S/C20H19FN4O4S2/c1-31(28,29)18(19(27)23-10-17(26)24-13-4-5-13)20-25-14-6-2-11(8-15(14)30-20)12-3-7-16(21)22-9-12/h2-3,6-9,13,18H,4-5,10H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | ZQLFQCLIZZQIPD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|