C32H33F6N3O3 — CID 118227103
4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-7-methyl-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-1-propan-2-ylindole-6-carboxamide (PubChem CID 118227103) has the molecular formula C32H33F6N3O3 and a molecular weight of 621.62 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-7-methyl-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-1-propan-2-ylindole-6-carboxamide.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-7-methyl-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-1-propan-2-ylindole-6-carboxamide |
|---|---|
| PubChem CID | 118227103 |
| Molecular Formula | C32H33F6N3O3 |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-7-methyl-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-1-propan-2-ylindole-6-carboxamide |
| SMILES | CCCc1cc(C)[nH]c(=O)c1CNC(=O)c1cc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c2ccn(C(C)C)c2c1C |
| InChI | InChI=1S/C32H33F6N3O3/c1-6-7-21-14-18(4)40-29(43)26(21)16-39-28(42)24-15-25(23-12-13-41(17(2)3)27(23)19(24)5)20-8-10-22(11-9-20)30(44,31(33,34)35)32(36,37)38/h8-15,17,44H,6-7,16H2,1-5H3,(H,39,42)(H,40,43) |
| InChIKey | BAQDGZTVJMWGHJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |