About 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine
1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine (PubChem CID 118227214) has the molecular formula C14H20BrF2N3
and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine |
| PubChem CID | 118227214 |
| Molecular Formula | C14H20BrF2N3 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine |
| SMILES | FC1(F)CCCN(C2CCCC(n3cc(Br)cn3)C2)C1 |
| InChI | InChI=1S/C14H20BrF2N3/c15-11-8-18-20(9-11)13-4-1-3-12(7-13)19-6-2-5-14(16,17)10-19/h8-9,12-13H,1-7,10H2 |
| InChIKey | QWGQJIRTWXGYNY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine?
The IUPAC name of 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine (CID 118227214) is 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine.
What is the SMILES notation for 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine?
The canonical SMILES for 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine is FC1(F)CCCN(C2CCCC(n3cc(Br)cn3)C2)C1.
What is the InChIKey of 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine?
The InChIKey is QWGQJIRTWXGYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrF2N3/c15-11-8-18-20(9-11)13-4-1-3-12(7-13)19-6-2-5-14(16,17)10-19/h8-9,12-13H,1-7,10H2.
What are the key properties of 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine?
1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine has a molecular weight of 348.24 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromopyrazol-1-yl)cyclohexyl]-3,3-difluoropiperidine is sourced from PubChem (CID 118227214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).