C23H24F2N2O4S — CID 118227331
2-[2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propan-2-yloxy]acetamide (PubChem CID 118227331) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propan-2-yloxy]acetamide.
| Compound Name | 2-[2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propan-2-yloxy]acetamide |
|---|---|
| PubChem CID | 118227331 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-4,5-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]propan-2-yloxy]acetamide |
| SMILES | C[C@H]1C(=O)C(=O)[C@@H](c2ccccc2)SN1Cc1cc(F)c(C(C)(C)OCC(N)=O)cc1F |
| InChI | InChI=1S/C23H24F2N2O4S/c1-13-20(29)21(30)22(14-7-5-4-6-8-14)32-27(13)11-15-9-18(25)16(10-17(15)24)23(2,3)31-12-19(26)28/h4-10,13,22H,11-12H2,1-3H3,(H2,26,28)/t13-,22+/m0/s1 |
| InChIKey | WXHJVGIFAAYGFR-WHEQGISXSA-N |
| XLogP | 3.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|