C10H11F9 — CID 11822771
1,1,2,2,3,3,4,4,4-nonafluorobutylcyclohexane (PubChem CID 11822771) has the molecular formula C10H11F9 and a molecular weight of 302.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclohexane |
|---|---|
| PubChem CID | 11822771 |
| Molecular Formula | C10H11F9 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C10H11F9/c11-7(12,6-4-2-1-3-5-6)8(13,14)9(15,16)10(17,18)19/h6H,1-5H2 |
| InChIKey | NNZVQGJXTKZNFP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|