C14H26OS — CID 118227801
4,4,5,7,8-pentamethyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-6-ol (PubChem CID 118227801) has the molecular formula C14H26OS and a molecular weight of 242.43 g/mol. Its IUPAC name is 4,4,5,7,8-pentamethyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-6-ol.
| Compound Name | 4,4,5,7,8-pentamethyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-6-ol |
|---|---|
| PubChem CID | 118227801 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 4,4,5,7,8-pentamethyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-6-ol |
| SMILES | CC1C(C)C2SCCC(C)(C)C2C(C)C1O |
| InChI | InChI=1S/C14H26OS/c1-8-9(2)13-11(10(3)12(8)15)14(4,5)6-7-16-13/h8-13,15H,6-7H2,1-5H3 |
| InChIKey | QYYSYUQEUXWEHT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |