About 5-N,3-dimethyl-1,2-oxazole-4,5-diamine
5-N,3-dimethyl-1,2-oxazole-4,5-diamine (PubChem CID 118227876) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 5-N,3-dimethyl-1,2-oxazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N,3-dimethyl-1,2-oxazole-4,5-diamine |
| PubChem CID | 118227876 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 5-N,3-dimethyl-1,2-oxazole-4,5-diamine |
| SMILES | CNc1onc(C)c1N |
| InChI | InChI=1S/C5H9N3O/c1-3-4(6)5(7-2)9-8-3/h7H,6H2,1-2H3 |
| InChIKey | CRKDPGHFGWMLRR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N,3-dimethyl-1,2-oxazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,3-dimethyl-1,2-oxazole-4,5-diamine?
The IUPAC name of 5-N,3-dimethyl-1,2-oxazole-4,5-diamine (CID 118227876) is 5-N,3-dimethyl-1,2-oxazole-4,5-diamine.
What is the SMILES notation for 5-N,3-dimethyl-1,2-oxazole-4,5-diamine?
The canonical SMILES for 5-N,3-dimethyl-1,2-oxazole-4,5-diamine is CNc1onc(C)c1N.
What is the InChIKey of 5-N,3-dimethyl-1,2-oxazole-4,5-diamine?
The InChIKey is CRKDPGHFGWMLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-3-4(6)5(7-2)9-8-3/h7H,6H2,1-2H3.
What are the key properties of 5-N,3-dimethyl-1,2-oxazole-4,5-diamine?
5-N,3-dimethyl-1,2-oxazole-4,5-diamine has a molecular weight of 127.15 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,3-dimethyl-1,2-oxazole-4,5-diamine is sourced from PubChem (CID 118227876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).