About 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole
2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole (PubChem CID 118227969) has the molecular formula C28H17N3OS
and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole |
| PubChem CID | 118227969 |
| Molecular Formula | C28H17N3OS |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(-c3cccc(-n4c5ccccc5c5c6sccc6ccc54)c3)o2)cc1 |
| InChI | InChI=1S/C28H17N3OS/c1-2-7-19(8-3-1)27-29-30-28(32-27)20-9-6-10-21(17-20)31-23-12-5-4-11-22(23)25-24(31)14-13-18-15-16-33-26(18)25/h1-17H |
| InChIKey | MUWJGRLDJHULAP-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole?
The IUPAC name of 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole (CID 118227969) is 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole is c1ccc(-c2nnc(-c3cccc(-n4c5ccccc5c5c6sccc6ccc54)c3)o2)cc1.
What is the InChIKey of 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole?
The InChIKey is MUWJGRLDJHULAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17N3OS/c1-2-7-19(8-3-1)27-29-30-28(32-27)20-9-6-10-21(17-20)31-23-12-5-4-11-22(23)25-24(31)14-13-18-15-16-33-26(18)25/h1-17H.
What are the key properties of 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole?
2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole has a molecular weight of 443.53 g/mol, XLogP of 7.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-(3-thieno[3,2-c]carbazol-6-ylphenyl)-1,3,4-oxadiazole is sourced from PubChem (CID 118227969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).