C40H25N3OS — CID 118227994
2-[3-(2,3-diphenylthieno[3,2-c]carbazol-6-yl)phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 118227994) has the molecular formula C40H25N3OS and a molecular weight of 595.73 g/mol. Its IUPAC name is 2-[3-(2,3-diphenylthieno[3,2-c]carbazol-6-yl)phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[3-(2,3-diphenylthieno[3,2-c]carbazol-6-yl)phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 118227994 |
| Molecular Formula | C40H25N3OS |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 2-[3-(2,3-diphenylthieno[3,2-c]carbazol-6-yl)phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(-c3cccc(-n4c5ccccc5c5c6sc(-c7ccccc7)c(-c7ccccc7)c6ccc54)c3)o2)cc1 |
| InChI | InChI=1S/C40H25N3OS/c1-4-13-26(14-5-1)35-32-23-24-34-36(38(32)45-37(35)27-15-6-2-7-16-27)31-21-10-11-22-33(31)43(34)30-20-12-19-29(25-30)40-42-41-39(44-40)28-17-8-3-9-18-28/h1-25H |
| InChIKey | MHNGZAIZCDKELA-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |