About (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine
(Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine (PubChem CID 118228085) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine |
| PubChem CID | 118228085 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N)c1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C13H12N4/c14-12(10-1-5-16-6-2-10)9-13(15)11-3-7-17-8-4-11/h1-9,14H,15H2/b13-9-,14-12- |
| InChIKey | HMISGFDCAMUFNO-YKCZHJISSA-N |
| XLogP | 1.84 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine?
The IUPAC name of (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine (CID 118228085) is (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine.
What is the SMILES notation for (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine?
The canonical SMILES for (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine is [H]/N=C(/C=C(\N)c1ccncc1)c1ccncc1.
What is the InChIKey of (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine?
The InChIKey is HMISGFDCAMUFNO-YKCZHJISSA-N. The full InChI is InChI=1S/C13H12N4/c14-12(10-1-5-16-6-2-10)9-13(15)11-3-7-17-8-4-11/h1-9,14H,15H2/b13-9-,14-12-.
What are the key properties of (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine?
(Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine has a molecular weight of 224.27 g/mol, XLogP of 1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-imino-1,3-dipyridin-4-ylprop-1-en-1-amine is sourced from PubChem (CID 118228085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).