C51H34N6O — CID 118228195
2,3-diphenyl-6-[4-[(4S,6S)-4-pyridin-4-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazabicyclo[3.1.0]hex-2-en-2-yl]phenyl]furo[3,2-c]carbazole (PubChem CID 118228195) has the molecular formula C51H34N6O and a molecular weight of 746.87 g/mol. Its IUPAC name is 2,3-diphenyl-6-[4-[(4S,6S)-4-pyridin-4-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazabicyclo[3.1.0]hex-2-en-2-yl]phenyl]furo[3,2-c]carbazole.
| Compound Name | 2,3-diphenyl-6-[4-[(4S,6S)-4-pyridin-4-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazabicyclo[3.1.0]hex-2-en-2-yl]phenyl]furo[3,2-c]carbazole |
|---|---|
| PubChem CID | 118228195 |
| Molecular Formula | C51H34N6O |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | 2,3-diphenyl-6-[4-[(4S,6S)-4-pyridin-4-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazabicyclo[3.1.0]hex-2-en-2-yl]phenyl]furo[3,2-c]carbazole |
| SMILES | c1ccc(-c2oc3c(ccc4c3c3ccccc3n4-c3ccc(C4=N[C@H](c5ccncc5)N5[C@H](c6ccc(-c7ccncc7)cc6)N45)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C51H34N6O/c1-3-9-35(10-4-1)45-42-23-24-44-46(48(42)58-47(45)36-11-5-2-6-12-36)41-13-7-8-14-43(41)55(44)40-21-19-37(20-22-40)49-54-50(38-27-31-53-32-28-38)57-51(56(49)57)39-17-15-33(16-18-39)34-25-29-52-30-26-34/h1-32,50-51H/t50-,51+,56?,57?/m0/s1 |
| InChIKey | OEDAKOPWEQNOEQ-XFDNXVFTSA-N |
| XLogP | 12.01 |
| TPSA | 62.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|