C21H20O2 — CID 11822858
(4aS)-4a-benzyl-7-hydroxy-3,4,9,10-tetrahydrophenanthren-2-one (PubChem CID 11822858) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4aS)-4a-benzyl-7-hydroxy-3,4,9,10-tetrahydrophenanthren-2-one.
| Compound Name | (4aS)-4a-benzyl-7-hydroxy-3,4,9,10-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 11822858 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (4aS)-4a-benzyl-7-hydroxy-3,4,9,10-tetrahydrophenanthren-2-one |
| SMILES | O=C1C=C2CCc3cc(O)ccc3[C@]2(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H20O2/c22-18-8-9-20-16(12-18)6-7-17-13-19(23)10-11-21(17,20)14-15-4-2-1-3-5-15/h1-5,8-9,12-13,22H,6-7,10-11,14H2/t21-/m0/s1 |
| InChIKey | RTYKMFMHRRYCIK-NRFANRHFSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |