About (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine
(2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine (PubChem CID 118228628) has the molecular formula C36H27N
and a molecular weight of 473.62 g/mol. Its IUPAC name is (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine.
Molecular Properties
| Compound Name | (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine |
| PubChem CID | 118228628 |
| Molecular Formula | C36H27N |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine |
| SMILES | C=C1/C=C\C(c2ccc3c(c2)c2c(c4ccccc43)C=CCC2)=C/N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C36H27N/c1-25-19-20-27(24-37(28-11-3-2-4-12-28)36-18-10-9-13-29(25)36)26-21-22-34-32-16-6-5-14-30(32)31-15-7-8-17-33(31)35(34)23-26/h2-7,9-16,18-24H,1,8,17H2/b20-19-,27-24+ |
| InChIKey | UUQPBIUTUKQGBF-WVDPKGDUSA-N |
| XLogP | 9.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine?
The IUPAC name of (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine (CID 118228628) is (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine.
What is the SMILES notation for (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine?
The canonical SMILES for (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine is C=C1/C=C\C(c2ccc3c(c2)c2c(c4ccccc43)C=CCC2)=C/N(c2ccccc2)c2ccccc21.
What is the InChIKey of (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine?
The InChIKey is UUQPBIUTUKQGBF-WVDPKGDUSA-N. The full InChI is InChI=1S/C36H27N/c1-25-19-20-27(24-37(28-11-3-2-4-12-28)36-18-10-9-13-29(25)36)26-21-22-34-32-16-6-5-14-30(32)31-15-7-8-17-33(31)35(34)23-26/h2-7,9-16,18-24H,1,8,17H2/b20-19-,27-24+.
What are the key properties of (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine?
(2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine has a molecular weight of 473.62 g/mol, XLogP of 9.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-3-(11,12-dihydrotriphenylen-2-yl)-6-methylidene-1-phenyl-1-benzazocine is sourced from PubChem (CID 118228628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).