About (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine
(4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine (PubChem CID 118228846) has the molecular formula C18H26N2S
and a molecular weight of 302.49 g/mol. Its IUPAC name is (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine.
Molecular Properties
| Compound Name | (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine |
| PubChem CID | 118228846 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine |
| SMILES | C=C(/C=C\C(=C)/C(C)=N/C=C(\C)CCCCCC)N=C=S |
| InChI | InChI=1S/C18H26N2S/c1-6-7-8-9-10-15(2)13-19-18(5)16(3)11-12-17(4)20-14-21/h11-13H,3-4,6-10H2,1-2,5H3/b12-11-,15-13+,19-18+ |
| InChIKey | XGRXLZCEUMTBMB-ZMBACTBMSA-N |
| XLogP | 6.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine?
The IUPAC name of (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine (CID 118228846) is (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine.
What is the SMILES notation for (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine?
The canonical SMILES for (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine is C=C(/C=C\C(=C)/C(C)=N/C=C(\C)CCCCCC)N=C=S.
What is the InChIKey of (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine?
The InChIKey is XGRXLZCEUMTBMB-ZMBACTBMSA-N. The full InChI is InChI=1S/C18H26N2S/c1-6-7-8-9-10-15(2)13-19-18(5)16(3)11-12-17(4)20-14-21/h11-13H,3-4,6-10H2,1-2,5H3/b12-11-,15-13+,19-18+.
What are the key properties of (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine?
(4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine has a molecular weight of 302.49 g/mol, XLogP of 6.05, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-6-isothiocyanato-3-methylidene-N-[(E)-2-methyloct-1-enyl]hepta-4,6-dien-2-imine is sourced from PubChem (CID 118228846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).