C33H20N6O — CID 118229476
6-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]furo[3,2-c]carbazole (PubChem CID 118229476) has the molecular formula C33H20N6O and a molecular weight of 516.56 g/mol. Its IUPAC name is 6-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]furo[3,2-c]carbazole.
| Compound Name | 6-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]furo[3,2-c]carbazole |
|---|---|
| PubChem CID | 118229476 |
| Molecular Formula | C33H20N6O |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 6-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]furo[3,2-c]carbazole |
| SMILES | c1ccc2c(c1)c1c3occc3ccc1n2-c1ccc(-c2nc(-c3ccncc3)nc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C33H20N6O/c1-2-4-27-26(3-1)29-28(10-7-21-15-20-40-30(21)29)39(27)25-8-5-22(6-9-25)31-36-32(23-11-16-34-17-12-23)38-33(37-31)24-13-18-35-19-14-24/h1-20H |
| InChIKey | YIGYFZXPFCLLSU-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |